C34H30Cl2N4O4S — CID 59305390
5-[3-[2-[[4-(3-butoxyphenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 59305390) has the molecular formula C34H30Cl2N4O4S and a molecular weight of 661.61 g/mol. Its IUPAC name is 5-[3-[2-[[4-(3-butoxyphenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[3-[2-[[4-(3-butoxyphenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 59305390 |
| Molecular Formula | C34H30Cl2N4O4S |
| Molecular Weight | 661.61 g/mol |
| Exact Mass | 660.14 |
| IUPAC Name | 5-[3-[2-[[4-(3-butoxyphenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CCCCOc1cccc(-c2ccc(Cc3nc(-c4ccc(Cl)cc4Cl)cn3-c3cccc(N4CC(=O)NS4(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C34H30Cl2N4O4S/c1-2-3-16-44-29-9-4-6-25(18-29)24-12-10-23(11-13-24)17-33-37-32(30-15-14-26(35)19-31(30)36)21-39(33)27-7-5-8-28(20-27)40-22-34(41)38-45(40,42)43/h4-15,18-21H,2-3,16-17,22H2,1H3,(H,38,41) |
| InChIKey | JAGVQTFVZQMVBR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.61 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|