About methyl 3-amino-4-chlorobenzoate
methyl 3-amino-4-chlorobenzoate (PubChem CID 593055) has the molecular formula C8H8ClNO2
and a molecular weight of 185.61 g/mol. Its IUPAC name is methyl 3-amino-4-chlorobenzoate.
Molecular Properties
| Compound Name | methyl 3-amino-4-chlorobenzoate |
| PubChem CID | 593055 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | methyl 3-amino-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C8H8ClNO2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,10H2,1H3 |
| InChIKey | LOCJPOYKBUUVKU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-4-chlorobenzoate?
The IUPAC name of methyl 3-amino-4-chlorobenzoate (CID 593055) is methyl 3-amino-4-chlorobenzoate.
What is the SMILES notation for methyl 3-amino-4-chlorobenzoate?
The canonical SMILES for methyl 3-amino-4-chlorobenzoate is COC(=O)c1ccc(Cl)c(N)c1.
What is the InChIKey of methyl 3-amino-4-chlorobenzoate?
The InChIKey is LOCJPOYKBUUVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,10H2,1H3.
What are the key properties of methyl 3-amino-4-chlorobenzoate?
methyl 3-amino-4-chlorobenzoate has a molecular weight of 185.61 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4-chlorobenzoate is sourced from PubChem (CID 593055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).