About 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate
3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate (PubChem CID 59305930) has the molecular formula C22H44O5SSi
and a molecular weight of 448.74 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate |
| PubChem CID | 59305930 |
| Molecular Formula | C22H44O5SSi |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate |
| SMILES | CCO[Si](CCCSCCC(=O)OCCC(C)CCC=C(C)C)(OCC)OCC |
| InChI | InChI=1S/C22H44O5SSi/c1-7-25-29(26-8-2,27-9-3)19-11-17-28-18-15-22(23)24-16-14-21(6)13-10-12-20(4)5/h12,21H,7-11,13-19H2,1-6H3 |
| InChIKey | SDMAGRDNRNPUKP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate (CID 59305930) is 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate is CCO[Si](CCCSCCC(=O)OCCC(C)CCC=C(C)C)(OCC)OCC.
What is the InChIKey of 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate?
The InChIKey is SDMAGRDNRNPUKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O5SSi/c1-7-25-29(26-8-2,27-9-3)19-11-17-28-18-15-22(23)24-16-14-21(6)13-10-12-20(4)5/h12,21H,7-11,13-19H2,1-6H3.
What are the key properties of 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate?
3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate has a molecular weight of 448.74 g/mol, XLogP of 5.86, 19 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl 3-(3-triethoxysilylpropylsulfanyl)propanoate is sourced from PubChem (CID 59305930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).