About 9-tert-butyl-4,5-dihydro-1H-purin-6-one
9-tert-butyl-4,5-dihydro-1H-purin-6-one (PubChem CID 59306065) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is 9-tert-butyl-4,5-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 9-tert-butyl-4,5-dihydro-1H-purin-6-one |
| PubChem CID | 59306065 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 9-tert-butyl-4,5-dihydro-1H-purin-6-one |
| SMILES | CC(C)(C)N1C=NC2C(=O)NC=NC21 |
| InChI | InChI=1S/C9H14N4O/c1-9(2,3)13-5-12-6-7(13)10-4-11-8(6)14/h4-7H,1-3H3,(H,10,11,14) |
| InChIKey | HLILUDDJQDWCLH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-tert-butyl-4,5-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-tert-butyl-4,5-dihydro-1H-purin-6-one?
The IUPAC name of 9-tert-butyl-4,5-dihydro-1H-purin-6-one (CID 59306065) is 9-tert-butyl-4,5-dihydro-1H-purin-6-one.
What is the SMILES notation for 9-tert-butyl-4,5-dihydro-1H-purin-6-one?
The canonical SMILES for 9-tert-butyl-4,5-dihydro-1H-purin-6-one is CC(C)(C)N1C=NC2C(=O)NC=NC21.
What is the InChIKey of 9-tert-butyl-4,5-dihydro-1H-purin-6-one?
The InChIKey is HLILUDDJQDWCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O/c1-9(2,3)13-5-12-6-7(13)10-4-11-8(6)14/h4-7H,1-3H3,(H,10,11,14).
What are the key properties of 9-tert-butyl-4,5-dihydro-1H-purin-6-one?
9-tert-butyl-4,5-dihydro-1H-purin-6-one has a molecular weight of 194.24 g/mol, XLogP of -0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-tert-butyl-4,5-dihydro-1H-purin-6-one is sourced from PubChem (CID 59306065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).