About 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid
3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 59306549) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid |
| PubChem CID | 59306549 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C(N)=O)C1C(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-7(2)3(5(8)9)4(7)6(10)11/h3-4H,1-2H3,(H2,8,9)(H,10,11) |
| InChIKey | CGKUBUVLQCVAKB-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
The IUPAC name of 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid (CID 59306549) is 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid.
What is the SMILES notation for 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
The canonical SMILES for 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid is CC1(C)C(C(N)=O)C1C(=O)O.
What is the InChIKey of 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
The InChIKey is CGKUBUVLQCVAKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-7(2)3(5(8)9)4(7)6(10)11/h3-4H,1-2H3,(H2,8,9)(H,10,11).
What are the key properties of 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of -0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbamoyl-2,2-dimethylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 59306549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).