C21H45N9 — CID 59307212
1,3,5-tris(2-piperazin-1-ylethyl)-1,3,5-triazinane (PubChem CID 59307212) has the molecular formula C21H45N9 and a molecular weight of 423.65 g/mol. Its IUPAC name is 1,3,5-tris(2-piperazin-1-ylethyl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(2-piperazin-1-ylethyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 59307212 |
| Molecular Formula | C21H45N9 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.38 |
| IUPAC Name | 1,3,5-tris(2-piperazin-1-ylethyl)-1,3,5-triazinane |
| SMILES | C1CN(CCN2CN(CCN3CCNCC3)CN(CCN3CCNCC3)C2)CCN1 |
| InChI | InChI=1S/C21H45N9/c1-7-25(8-2-22-1)13-16-28-19-29(17-14-26-9-3-23-4-10-26)21-30(20-28)18-15-27-11-5-24-6-12-27/h22-24H,1-21H2 |
| InChIKey | JHLUTBDSZHNAAJ-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 55.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |