C20H36N2O3 — CID 59307219
1-[2-(2-hydroxyethylamino)ethyl]-3-(2,4,4,6,6-pentamethylhept-1-en-3-yl)pyrrolidine-2,5-dione (PubChem CID 59307219) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethylamino)ethyl]-3-(2,4,4,6,6-pentamethylhept-1-en-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(2-hydroxyethylamino)ethyl]-3-(2,4,4,6,6-pentamethylhept-1-en-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59307219 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 1-[2-(2-hydroxyethylamino)ethyl]-3-(2,4,4,6,6-pentamethylhept-1-en-3-yl)pyrrolidine-2,5-dione |
| SMILES | C=C(C)C(C1CC(=O)N(CCNCCO)C1=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H36N2O3/c1-14(2)17(20(6,7)13-19(3,4)5)15-12-16(24)22(18(15)25)10-8-21-9-11-23/h15,17,21,23H,1,8-13H2,2-7H3 |
| InChIKey | WQRDWVBCLCAANQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|