C31H42N2O3 — CID 59307222
1-[2-(2-naphthalen-2-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione (PubChem CID 59307222) has the molecular formula C31H42N2O3 and a molecular weight of 490.69 g/mol. Its IUPAC name is 1-[2-(2-naphthalen-2-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(2-naphthalen-2-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59307222 |
| Molecular Formula | C31H42N2O3 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | 1-[2-(2-naphthalen-2-yl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione |
| SMILES | C=C(CC1CC(=O)N(CCN2CCOC2c2ccc3ccccc3c2)C1=O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C31H42N2O3/c1-22(20-31(5,6)21-30(2,3)4)17-26-19-27(34)33(28(26)35)14-13-32-15-16-36-29(32)25-12-11-23-9-7-8-10-24(23)18-25/h7-12,18,26,29H,1,13-17,19-21H2,2-6H3 |
| InChIKey | GRXUFFLROAVOEY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|