C22H20N2 — CID 59307444
1-[3-(4-ethenylphenyl)phenyl]-3-methyl-2H-benzimidazole (PubChem CID 59307444) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-[3-(4-ethenylphenyl)phenyl]-3-methyl-2H-benzimidazole.
| Compound Name | 1-[3-(4-ethenylphenyl)phenyl]-3-methyl-2H-benzimidazole |
|---|---|
| PubChem CID | 59307444 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[3-(4-ethenylphenyl)phenyl]-3-methyl-2H-benzimidazole |
| SMILES | C=Cc1ccc(-c2cccc(N3CN(C)c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C22H20N2/c1-3-17-11-13-18(14-12-17)19-7-6-8-20(15-19)24-16-23(2)21-9-4-5-10-22(21)24/h3-15H,1,16H2,2H3 |
| InChIKey | QFBFASWCRMWXMF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |