C15H38N3+3 — CID 59309258
bis[diethyl(methyl)azaniumyl]methyl-ethyl-dimethylazanium (PubChem CID 59309258) has the molecular formula C15H38N3+3 and a molecular weight of 260.49 g/mol. Its IUPAC name is bis[diethyl(methyl)azaniumyl]methyl-ethyl-dimethylazanium.
| Compound Name | bis[diethyl(methyl)azaniumyl]methyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 59309258 |
| Molecular Formula | C15H38N3+3 |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.30 |
| IUPAC Name | bis[diethyl(methyl)azaniumyl]methyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)C([N+](C)(CC)CC)[N+](C)(CC)CC |
| InChI | InChI=1S/C15H38N3/c1-10-16(6,7)15(17(8,11-2)12-3)18(9,13-4)14-5/h15H,10-14H2,1-9H3/q+3 |
| InChIKey | UCHGPUSTFZDFCY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|