About bis(2-ethyl-3-hydroxybutanedioic acid);yttrium
bis(2-ethyl-3-hydroxybutanedioic acid);yttrium (PubChem CID 59309351) has the molecular formula C12H18O10Y-2
and a molecular weight of 411.17 g/mol. Its IUPAC name is bis(2-ethyl-3-hydroxybutanedioic acid);yttrium.
Molecular Properties
| Compound Name | bis(2-ethyl-3-hydroxybutanedioic acid);yttrium |
| PubChem CID | 59309351 |
| Molecular Formula | C12H18O10Y-2 |
| Molecular Weight | 411.17 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | bis(2-ethyl-3-hydroxybutanedioic acid);yttrium |
| SMILES | C[CH-]C(C(=O)O)C(O)C(=O)O.C[CH-]C(C(=O)O)C(O)C(=O)O.[Y] |
| InChI | InChI=1S/2C6H9O5.Y/c2*1-2-3(5(8)9)4(7)6(10)11;/h2*2-4,7H,1H3,(H,8,9)(H,10,11);/q2*-1; |
| InChIKey | PGVRWJBEHUHZKB-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.17 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethyl-3-hydroxybutanedioic acid);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethyl-3-hydroxybutanedioic acid);yttrium?
The IUPAC name of bis(2-ethyl-3-hydroxybutanedioic acid);yttrium (CID 59309351) is bis(2-ethyl-3-hydroxybutanedioic acid);yttrium.
What is the SMILES notation for bis(2-ethyl-3-hydroxybutanedioic acid);yttrium?
The canonical SMILES for bis(2-ethyl-3-hydroxybutanedioic acid);yttrium is C[CH-]C(C(=O)O)C(O)C(=O)O.C[CH-]C(C(=O)O)C(O)C(=O)O.[Y].
What is the InChIKey of bis(2-ethyl-3-hydroxybutanedioic acid);yttrium?
The InChIKey is PGVRWJBEHUHZKB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H9O5.Y/c2*1-2-3(5(8)9)4(7)6(10)11;/h2*2-4,7H,1H3,(H,8,9)(H,10,11);/q2*-1;.
What are the key properties of bis(2-ethyl-3-hydroxybutanedioic acid);yttrium?
bis(2-ethyl-3-hydroxybutanedioic acid);yttrium has a molecular weight of 411.17 g/mol, XLogP of -1.29, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethyl-3-hydroxybutanedioic acid);yttrium is sourced from PubChem (CID 59309351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).