C11H20OS — CID 59309454
2-cyclohexyl-4-methyl-1,3-oxathiane (PubChem CID 59309454) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-cyclohexyl-4-methyl-1,3-oxathiane.
| Compound Name | 2-cyclohexyl-4-methyl-1,3-oxathiane |
|---|---|
| PubChem CID | 59309454 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-cyclohexyl-4-methyl-1,3-oxathiane |
| SMILES | CC1CCOC(C2CCCCC2)S1 |
| InChI | InChI=1S/C11H20OS/c1-9-7-8-12-11(13-9)10-5-3-2-4-6-10/h9-11H,2-8H2,1H3 |
| InChIKey | UTLMSKTWBOWHLQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |