C35H49N3O6P+ — CID 59309571
[2-[[1-(4-amino-4-oxo-3,3-diphenylbutyl)azepan-1-ium-1-yl]methyl]-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] dihydrogen phosphate (PubChem CID 59309571) has the molecular formula C35H49N3O6P+ and a molecular weight of 638.77 g/mol. Its IUPAC name is [2-[[1-(4-amino-4-oxo-3,3-diphenylbutyl)azepan-1-ium-1-yl]methyl]-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-[[1-(4-amino-4-oxo-3,3-diphenylbutyl)azepan-1-ium-1-yl]methyl]-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59309571 |
| Molecular Formula | C35H49N3O6P+ |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.34 |
| IUPAC Name | [2-[[1-(4-amino-4-oxo-3,3-diphenylbutyl)azepan-1-ium-1-yl]methyl]-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] dihydrogen phosphate |
| SMILES | CC(C)(C)NCC(O)c1ccc(OP(=O)(O)O)c(C[N+]2(CCC(C(N)=O)(c3ccccc3)c3ccccc3)CCCCCC2)c1 |
| InChI | InChI=1S/C35H48N3O6P/c1-34(2,3)37-25-31(39)27-18-19-32(44-45(41,42)43)28(24-27)26-38(21-12-4-5-13-22-38)23-20-35(33(36)40,29-14-8-6-9-15-29)30-16-10-7-11-17-30/h6-11,14-19,24,31,37,39H,4-5,12-13,20-23,25-26H2,1-3H3,(H3-,36,40,41,42,43)/p+1 |
| InChIKey | FJSKUYPHVQOFIH-UHFFFAOYSA-O |
| XLogP | 5.33 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|