About 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline
2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline (PubChem CID 59309799) has the molecular formula C16H16ClF2NOS
and a molecular weight of 343.83 g/mol. Its IUPAC name is 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline.
Molecular Properties
| Compound Name | 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline |
| PubChem CID | 59309799 |
| Molecular Formula | C16H16ClF2NOS |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline |
| SMILES | COc1ccc(F)c(F)c1C(C)(C)Sc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C16H16ClF2NOS/c1-16(2,22-9-4-5-10(17)12(20)8-9)14-13(21-3)7-6-11(18)15(14)19/h4-8H,20H2,1-3H3 |
| InChIKey | RRGNLLKAJMGDAL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline?
The IUPAC name of 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline (CID 59309799) is 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline.
What is the SMILES notation for 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline?
The canonical SMILES for 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline is COc1ccc(F)c(F)c1C(C)(C)Sc1ccc(Cl)c(N)c1.
What is the InChIKey of 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline?
The InChIKey is RRGNLLKAJMGDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClF2NOS/c1-16(2,22-9-4-5-10(17)12(20)8-9)14-13(21-3)7-6-11(18)15(14)19/h4-8H,20H2,1-3H3.
What are the key properties of 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline?
2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline has a molecular weight of 343.83 g/mol, XLogP of 5.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[2-(2,3-difluoro-6-methoxyphenyl)propan-2-ylsulfanyl]aniline is sourced from PubChem (CID 59309799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).