About 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline
2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline (PubChem CID 59310129) has the molecular formula C17H18ClF2NO4
and a molecular weight of 373.78 g/mol. Its IUPAC name is 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline.
Molecular Properties
| Compound Name | 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline |
| PubChem CID | 59310129 |
| Molecular Formula | C17H18ClF2NO4 |
| Molecular Weight | 373.78 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline |
| SMILES | COCCOc1cc(Cl)c(N)cc1OCc1c(OC)ccc(F)c1F |
| InChI | InChI=1S/C17H18ClF2NO4/c1-22-5-6-24-15-7-11(18)13(21)8-16(15)25-9-10-14(23-2)4-3-12(19)17(10)20/h3-4,7-8H,5-6,9,21H2,1-2H3 |
| InChIKey | CCSHZLIIRZMRKQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline?
The IUPAC name of 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline (CID 59310129) is 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline.
What is the SMILES notation for 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline?
The canonical SMILES for 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline is COCCOc1cc(Cl)c(N)cc1OCc1c(OC)ccc(F)c1F.
What is the InChIKey of 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline?
The InChIKey is CCSHZLIIRZMRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClF2NO4/c1-22-5-6-24-15-7-11(18)13(21)8-16(15)25-9-10-14(23-2)4-3-12(19)17(10)20/h3-4,7-8H,5-6,9,21H2,1-2H3.
What are the key properties of 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline?
2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline has a molecular weight of 373.78 g/mol, XLogP of 3.81, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-4-(2-methoxyethoxy)aniline is sourced from PubChem (CID 59310129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).