C16H22N2O3S4 — CID 59310330
3-[[5-[(4-butan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]propane-1-sulfonic acid (PubChem CID 59310330) has the molecular formula C16H22N2O3S4 and a molecular weight of 418.63 g/mol. Its IUPAC name is 3-[[5-[(4-butan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]propane-1-sulfonic acid.
| Compound Name | 3-[[5-[(4-butan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59310330 |
| Molecular Formula | C16H22N2O3S4 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 3-[[5-[(4-butan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]propane-1-sulfonic acid |
| SMILES | CCC(C)c1ccc(CSc2nnc(SCCCS(=O)(=O)O)s2)cc1 |
| InChI | InChI=1S/C16H22N2O3S4/c1-3-12(2)14-7-5-13(6-8-14)11-23-16-18-17-15(24-16)22-9-4-10-25(19,20)21/h5-8,12H,3-4,9-11H2,1-2H3,(H,19,20,21) |
| InChIKey | GDLBETYSNHMCQO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|