C20H23F5O4 — CID 59310372
[5,5-difluoro-6-methyl-6-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)-4-(trifluoromethyl)-1,3-dioxan-4-yl] acetate (PubChem CID 59310372) has the molecular formula C20H23F5O4 and a molecular weight of 422.39 g/mol. Its IUPAC name is [5,5-difluoro-6-methyl-6-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)-4-(trifluoromethyl)-1,3-dioxan-4-yl] acetate.
| Compound Name | [5,5-difluoro-6-methyl-6-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)-4-(trifluoromethyl)-1,3-dioxan-4-yl] acetate |
|---|---|
| PubChem CID | 59310372 |
| Molecular Formula | C20H23F5O4 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [5,5-difluoro-6-methyl-6-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)-4-(trifluoromethyl)-1,3-dioxan-4-yl] acetate |
| SMILES | CC(=O)OC1(C(F)(F)F)OCOC(C)(C2CC3CC2C2C4C=CC(C4)C32)C1(F)F |
| InChI | InChI=1S/C20H23F5O4/c1-9(26)29-19(20(23,24)25)18(21,22)17(2,27-8-28-19)14-7-12-6-13(14)16-11-4-3-10(5-11)15(12)16/h3-4,10-16H,5-8H2,1-2H3 |
| InChIKey | HGZXCSRFQFFZMV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|