C29H33F5O6 — CID 59310438
[4-acetyloxy-5,5-difluoro-4-(trifluoromethyl)spiro[1,3-dioxane-6,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 59310438) has the molecular formula C29H33F5O6 and a molecular weight of 572.57 g/mol. Its IUPAC name is [4-acetyloxy-5,5-difluoro-4-(trifluoromethyl)spiro[1,3-dioxane-6,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | [4-acetyloxy-5,5-difluoro-4-(trifluoromethyl)spiro[1,3-dioxane-6,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 59310438 |
| Molecular Formula | C29H33F5O6 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | [4-acetyloxy-5,5-difluoro-4-(trifluoromethyl)spiro[1,3-dioxane-6,4'-adamantane]-1'-yl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC(=O)OC1(C(F)(F)F)OCOC2(C3CC4CC2CC(OC(=O)C2CC5CC2C2C6C=CC(C6)C52)(C4)C3)C1(F)F |
| InChI | InChI=1S/C29H33F5O6/c1-13(35)39-28(29(32,33)34)27(30,31)26(37-12-38-28)18-4-14-5-19(26)11-25(9-14,10-18)40-24(36)21-8-17-7-20(21)23-16-3-2-15(6-16)22(17)23/h2-3,14-23H,4-12H2,1H3 |
| InChIKey | UDXLIXTVLQPNLB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|