C16H21F5O3 — CID 59310450
6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-4-methoxy-2-propyl-4-(trifluoromethyl)-1,3-dioxane (PubChem CID 59310450) has the molecular formula C16H21F5O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-4-methoxy-2-propyl-4-(trifluoromethyl)-1,3-dioxane.
| Compound Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-4-methoxy-2-propyl-4-(trifluoromethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 59310450 |
| Molecular Formula | C16H21F5O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-5,5-difluoro-4-methoxy-2-propyl-4-(trifluoromethyl)-1,3-dioxane |
| SMILES | CCCC1OC(C2CC3C=CC2C3)C(F)(F)C(OC)(C(F)(F)F)O1 |
| InChI | InChI=1S/C16H21F5O3/c1-3-4-12-23-13(11-8-9-5-6-10(11)7-9)14(17,18)15(22-2,24-12)16(19,20)21/h5-6,9-13H,3-4,7-8H2,1-2H3 |
| InChIKey | CCFQKLKBCHUCDA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|