C19H27F5O4 — CID 59310475
6-(2-bicyclo[2.2.1]hept-5-enyl)-4-(1-ethoxyethoxy)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxane (PubChem CID 59310475) has the molecular formula C19H27F5O4 and a molecular weight of 414.41 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]hept-5-enyl)-4-(1-ethoxyethoxy)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxane.
| Compound Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-4-(1-ethoxyethoxy)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 59310475 |
| Molecular Formula | C19H27F5O4 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-4-(1-ethoxyethoxy)-5,5-difluoro-2-propyl-4-(trifluoromethyl)-1,3-dioxane |
| SMILES | CCCC1OC(C2CC3C=CC2C3)C(F)(F)C(OC(C)OCC)(C(F)(F)F)O1 |
| InChI | InChI=1S/C19H27F5O4/c1-4-6-15-26-16(14-10-12-7-8-13(14)9-12)17(20,21)18(28-15,19(22,23)24)27-11(3)25-5-2/h7-8,11-16H,4-6,9-10H2,1-3H3 |
| InChIKey | JZDQOTDCIRQPMF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|