C20H21F5O5 — CID 59310478
[12-acetyloxy-13,13-difluoro-12-(trifluoromethyl)-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-en-14-yl] acetate (PubChem CID 59310478) has the molecular formula C20H21F5O5 and a molecular weight of 436.37 g/mol. Its IUPAC name is [12-acetyloxy-13,13-difluoro-12-(trifluoromethyl)-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-en-14-yl] acetate.
| Compound Name | [12-acetyloxy-13,13-difluoro-12-(trifluoromethyl)-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-en-14-yl] acetate |
|---|---|
| PubChem CID | 59310478 |
| Molecular Formula | C20H21F5O5 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [12-acetyloxy-13,13-difluoro-12-(trifluoromethyl)-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-en-14-yl] acetate |
| SMILES | CC(=O)OC12C(COC(OC(C)=O)(C(F)(F)F)C1(F)F)C1CC2C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C20H21F5O5/c1-8(26)29-17-13-6-12(15-10-3-4-11(5-10)16(13)15)14(17)7-28-19(18(17,21)22,20(23,24)25)30-9(2)27/h3-4,10-16H,5-7H2,1-2H3 |
| InChIKey | IYTPWVQUWQSVCS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|