C18H19F5O7 — CID 59310534
[3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59310534) has the molecular formula C18H19F5O7 and a molecular weight of 442.33 g/mol. Its IUPAC name is [3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 59310534 |
| Molecular Formula | C18H19F5O7 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(=O)OC1C(COC(=O)C2CC3C=CC2C3)OC(OC(C)=O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C18H19F5O7/c1-8(24)28-14-13(7-27-15(26)12-6-10-3-4-11(12)5-10)30-17(16(14,19)20,18(21,22)23)29-9(2)25/h3-4,10-14H,5-7H2,1-2H3 |
| InChIKey | WIIWNNJHBRENHY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|