C24H24N4 — CID 59311768
1-cyclohexyl-4,6-diphenylpyrazolo[5,4-b]pyridin-3-amine (PubChem CID 59311768) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-cyclohexyl-4,6-diphenylpyrazolo[5,4-b]pyridin-3-amine.
| Compound Name | 1-cyclohexyl-4,6-diphenylpyrazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 59311768 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-cyclohexyl-4,6-diphenylpyrazolo[5,4-b]pyridin-3-amine |
| SMILES | Nc1nn(C2CCCCC2)c2nc(-c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C24H24N4/c25-23-22-20(17-10-4-1-5-11-17)16-21(18-12-6-2-7-13-18)26-24(22)28(27-23)19-14-8-3-9-15-19/h1-2,4-7,10-13,16,19H,3,8-9,14-15H2,(H2,25,27) |
| InChIKey | GERSXYIISMMUGC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |