About 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum
1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum (PubChem CID 59312019) has the molecular formula C7H10LaN3O2-
and a molecular weight of 307.08 g/mol. Its IUPAC name is 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum.
Molecular Properties
| Compound Name | 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum |
| PubChem CID | 59312019 |
| Molecular Formula | C7H10LaN3O2- |
| Molecular Weight | 307.08 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum |
| SMILES | O=C1NC(=O)C2(CC[N-]CC2)N1.[La] |
| InChI | InChI=1S/C7H10N3O2.La/c11-5-7(10-6(12)9-5)1-3-8-4-2-7;/h1-4H2,(H2,9,10,11,12);/q-1; |
| InChIKey | BBUZNCIMBWYRHJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.08 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum?
The IUPAC name of 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum (CID 59312019) is 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum.
What is the SMILES notation for 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum?
The canonical SMILES for 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum is O=C1NC(=O)C2(CC[N-]CC2)N1.[La].
What is the InChIKey of 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum?
The InChIKey is BBUZNCIMBWYRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N3O2.La/c11-5-7(10-6(12)9-5)1-3-8-4-2-7;/h1-4H2,(H2,9,10,11,12);/q-1;.
What are the key properties of 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum?
1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum has a molecular weight of 307.08 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diaza-8-azanidaspiro[4.5]decane-2,4-dione;lanthanum is sourced from PubChem (CID 59312019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).