About spiro[3H-chromene-2,4'-azepane]-4-one
spiro[3H-chromene-2,4'-azepane]-4-one (PubChem CID 59312111) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is spiro[3H-chromene-2,4'-azepane]-4-one.
Molecular Properties
| Compound Name | spiro[3H-chromene-2,4'-azepane]-4-one |
| PubChem CID | 59312111 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | spiro[3H-chromene-2,4'-azepane]-4-one |
| SMILES | O=C1CC2(CCCNCC2)Oc2ccccc21 |
| InChI | InChI=1S/C14H17NO2/c16-12-10-14(6-3-8-15-9-7-14)17-13-5-2-1-4-11(12)13/h1-2,4-5,15H,3,6-10H2 |
| InChIKey | FDPMEAVHGULMDJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[3H-chromene-2,4'-azepane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-chromene-2,4'-azepane]-4-one?
The IUPAC name of spiro[3H-chromene-2,4'-azepane]-4-one (CID 59312111) is spiro[3H-chromene-2,4'-azepane]-4-one.
What is the SMILES notation for spiro[3H-chromene-2,4'-azepane]-4-one?
The canonical SMILES for spiro[3H-chromene-2,4'-azepane]-4-one is O=C1CC2(CCCNCC2)Oc2ccccc21.
What is the InChIKey of spiro[3H-chromene-2,4'-azepane]-4-one?
The InChIKey is FDPMEAVHGULMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c16-12-10-14(6-3-8-15-9-7-14)17-13-5-2-1-4-11(12)13/h1-2,4-5,15H,3,6-10H2.
What are the key properties of spiro[3H-chromene-2,4'-azepane]-4-one?
spiro[3H-chromene-2,4'-azepane]-4-one has a molecular weight of 231.29 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-chromene-2,4'-azepane]-4-one is sourced from PubChem (CID 59312111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).