C22H27F3N4O5S — CID 59312337
tert-butyl 2-[benzyl(methyl)amino]-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate (PubChem CID 59312337) has the molecular formula C22H27F3N4O5S and a molecular weight of 516.54 g/mol. Its IUPAC name is tert-butyl 2-[benzyl(methyl)amino]-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 2-[benzyl(methyl)amino]-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 59312337 |
| Molecular Formula | C22H27F3N4O5S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | tert-butyl 2-[benzyl(methyl)amino]-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
| SMILES | CN(Cc1ccccc1)c1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C22H27F3N4O5S/c1-21(2,3)33-20(30)29-12-10-16-17(11-13-29)26-19(28(4)14-15-8-6-5-7-9-15)27-18(16)34-35(31,32)22(23,24)25/h5-9H,10-14H2,1-4H3 |
| InChIKey | HENRRGPISFMAKZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|