C20H18Cl2N8O2 — CID 59312931
6-N-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]propyl]-3-nitropyridine-2,6-diamine (PubChem CID 59312931) has the molecular formula C20H18Cl2N8O2 and a molecular weight of 473.32 g/mol. Its IUPAC name is 6-N-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]propyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]propyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59312931 |
| Molecular Formula | C20H18Cl2N8O2 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 6-N-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]propyl]-3-nitropyridine-2,6-diamine |
| SMILES | CC(CNc1ccc([N+](=O)[O-])c(N)n1)Nc1nc(-c2ccc(Cl)cc2Cl)cc2nccn12 |
| InChI | InChI=1S/C20H18Cl2N8O2/c1-11(10-25-17-5-4-16(30(31)32)19(23)28-17)26-20-27-15(9-18-24-6-7-29(18)20)13-3-2-12(21)8-14(13)22/h2-9,11H,10H2,1H3,(H,26,27)(H3,23,25,28) |
| InChIKey | XGNOLTMJACNYNY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|