C22H22Cl2N10OS — CID 59312967
4-amino-2-[2-[[7-(2,4-dichlorophenyl)-2-(morpholin-4-ylmethyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazole-5-carbonitrile (PubChem CID 59312967) has the molecular formula C22H22Cl2N10OS and a molecular weight of 545.46 g/mol. Its IUPAC name is 4-amino-2-[2-[[7-(2,4-dichlorophenyl)-2-(morpholin-4-ylmethyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-amino-2-[2-[[7-(2,4-dichlorophenyl)-2-(morpholin-4-ylmethyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 59312967 |
| Molecular Formula | C22H22Cl2N10OS |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 4-amino-2-[2-[[7-(2,4-dichlorophenyl)-2-(morpholin-4-ylmethyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1sc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cc3nc(CN4CCOCC4)nn23)nc1N |
| InChI | InChI=1S/C22H22Cl2N10OS/c23-13-1-2-14(15(24)9-13)16-10-19-30-18(12-33-5-7-35-8-6-33)32-34(19)21(29-16)27-3-4-28-22-31-20(26)17(11-25)36-22/h1-2,9-10H,3-8,12,26H2,(H,27,29)(H,28,31) |
| InChIKey | MYBHFPMNMSENAS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|