C22H23Cl2N9O2 — CID 59312974
6-N-[2-[[7-(2,4-dichlorophenyl)-2-[(dimethylamino)methyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 59312974) has the molecular formula C22H23Cl2N9O2 and a molecular weight of 516.39 g/mol. Its IUPAC name is 6-N-[2-[[7-(2,4-dichlorophenyl)-2-[(dimethylamino)methyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[7-(2,4-dichlorophenyl)-2-[(dimethylamino)methyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59312974 |
| Molecular Formula | C22H23Cl2N9O2 |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 6-N-[2-[[7-(2,4-dichlorophenyl)-2-[(dimethylamino)methyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | CN(C)Cc1cn2c(NCCNc3ccc([N+](=O)[O-])c(N)n3)nc(-c3ccc(Cl)cc3Cl)cc2n1 |
| InChI | InChI=1S/C22H23Cl2N9O2/c1-31(2)11-14-12-32-20(28-14)10-17(15-4-3-13(23)9-16(15)24)29-22(32)27-8-7-26-19-6-5-18(33(34)35)21(25)30-19/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,27,29)(H3,25,26,30) |
| InChIKey | GGINILYDQBFEDJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|