C20H15Cl2F3N8O2 — CID 59313088
6-N-[2-[[7-(2,4-dichlorophenyl)-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 59313088) has the molecular formula C20H15Cl2F3N8O2 and a molecular weight of 527.29 g/mol. Its IUPAC name is 6-N-[2-[[7-(2,4-dichlorophenyl)-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[7-(2,4-dichlorophenyl)-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59313088 |
| Molecular Formula | C20H15Cl2F3N8O2 |
| Molecular Weight | 527.29 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 6-N-[2-[[7-(2,4-dichlorophenyl)-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cc3nc(C(F)(F)F)cn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15Cl2F3N8O2/c21-10-1-2-11(12(22)7-10)13-8-17-30-15(20(23,24)25)9-32(17)19(29-13)28-6-5-27-16-4-3-14(33(34)35)18(26)31-16/h1-4,7-9H,5-6H2,(H,28,29)(H3,26,27,31) |
| InChIKey | JNCJGPKPZVUMJI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|