C18H22ClN9O3 — CID 59313100
6-N-[2-[[7-chloro-2-(morpholin-4-ylmethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 59313100) has the molecular formula C18H22ClN9O3 and a molecular weight of 447.89 g/mol. Its IUPAC name is 6-N-[2-[[7-chloro-2-(morpholin-4-ylmethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[7-chloro-2-(morpholin-4-ylmethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59313100 |
| Molecular Formula | C18H22ClN9O3 |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 6-N-[2-[[7-chloro-2-(morpholin-4-ylmethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2nc(Cl)cc3nc(CN4CCOCC4)cn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22ClN9O3/c19-14-9-16-23-12(10-26-5-7-31-8-6-26)11-27(16)18(24-14)22-4-3-21-15-2-1-13(28(29)30)17(20)25-15/h1-2,9,11H,3-8,10H2,(H,22,24)(H3,20,21,25) |
| InChIKey | MJGMEPSSHIDVKV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|