C19H17FN8O2 — CID 59313153
6-N-[2-[[7-(3-fluorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 59313153) has the molecular formula C19H17FN8O2 and a molecular weight of 408.40 g/mol. Its IUPAC name is 6-N-[2-[[7-(3-fluorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[7-(3-fluorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59313153 |
| Molecular Formula | C19H17FN8O2 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-N-[2-[[7-(3-fluorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2nc(-c3cccc(F)c3)cc3nccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17FN8O2/c20-13-3-1-2-12(10-13)14-11-17-23-8-9-27(17)19(25-14)24-7-6-22-16-5-4-15(28(29)30)18(21)26-16/h1-5,8-11H,6-7H2,(H,24,25)(H3,21,22,26) |
| InChIKey | ODEHUXWQMDBHTG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|