C9H5ClF3N5 — CID 59313847
6-chloro-3-isocyano-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine (PubChem CID 59313847) has the molecular formula C9H5ClF3N5 and a molecular weight of 275.62 g/mol. Its IUPAC name is 6-chloro-3-isocyano-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine.
| Compound Name | 6-chloro-3-isocyano-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine |
|---|---|
| PubChem CID | 59313847 |
| Molecular Formula | C9H5ClF3N5 |
| Molecular Weight | 275.62 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 6-chloro-3-isocyano-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine |
| SMILES | [C-]#[N+]c1cnc2c(NCC(F)(F)F)cc(Cl)nn12 |
| InChI | InChI=1S/C9H5ClF3N5/c1-14-7-3-15-8-5(16-4-9(11,12)13)2-6(10)17-18(7)8/h2-3,16H,4H2 |
| InChIKey | RUYUSSNJQOVNOT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|