About 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine
6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine (PubChem CID 59313898) has the molecular formula C19H18ClN5O
and a molecular weight of 367.84 g/mol. Its IUPAC name is 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine.
Molecular Properties
| Compound Name | 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine |
| PubChem CID | 59313898 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine |
| SMILES | [C-]#[N+]c1cnc2c(N(Cc3ccc(OC)cc3)C3CCC3)cc(Cl)nn12 |
| InChI | InChI=1S/C19H18ClN5O/c1-21-18-11-22-19-16(10-17(20)23-25(18)19)24(14-4-3-5-14)12-13-6-8-15(26-2)9-7-13/h6-11,14H,3-5,12H2,2H3 |
| InChIKey | LBPRASMWSHUPQB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine?
The IUPAC name of 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine (CID 59313898) is 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine.
What is the SMILES notation for 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine?
The canonical SMILES for 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine is [C-]#[N+]c1cnc2c(N(Cc3ccc(OC)cc3)C3CCC3)cc(Cl)nn12.
What is the InChIKey of 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine?
The InChIKey is LBPRASMWSHUPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN5O/c1-21-18-11-22-19-16(10-17(20)23-25(18)19)24(14-4-3-5-14)12-13-6-8-15(26-2)9-7-13/h6-11,14H,3-5,12H2,2H3.
What are the key properties of 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine?
6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine has a molecular weight of 367.84 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-cyclobutyl-3-isocyano-N-[(4-methoxyphenyl)methyl]imidazo[1,2-b]pyridazin-8-amine is sourced from PubChem (CID 59313898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).