C25H29NO3 — CID 59314388
ethyl (1R,3S)-1,3-dimethyl-2-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3-dihydroindene-2-carboxylate (PubChem CID 59314388) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl (1R,3S)-1,3-dimethyl-2-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl (1R,3S)-1,3-dimethyl-2-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 59314388 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl (1R,3S)-1,3-dimethyl-2-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)c2cccc3c2CCCC3)[C@H](C)c2ccccc2[C@@H]1C |
| InChI | InChI=1S/C25H29NO3/c1-4-29-24(28)25(16(2)19-12-7-8-13-20(19)17(25)3)26-23(27)22-15-9-11-18-10-5-6-14-21(18)22/h7-9,11-13,15-17H,4-6,10,14H2,1-3H3,(H,26,27)/t16-,17+,25? |
| InChIKey | WUHNAPBLXGSPMH-BXQQJGBQSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |