C10H6Br2O5 — CID 59314569
(Z)-4-(3,5-dibromo-4-hydroxyphenyl)-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 59314569) has the molecular formula C10H6Br2O5 and a molecular weight of 365.96 g/mol. Its IUPAC name is (Z)-4-(3,5-dibromo-4-hydroxyphenyl)-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-(3,5-dibromo-4-hydroxyphenyl)-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 59314569 |
| Molecular Formula | C10H6Br2O5 |
| Molecular Weight | 365.96 g/mol |
| Exact Mass | 363.86 |
| IUPAC Name | (Z)-4-(3,5-dibromo-4-hydroxyphenyl)-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C10H6Br2O5/c11-5-1-4(2-6(12)9(5)15)7(13)3-8(14)10(16)17/h1-3,13,15H,(H,16,17)/b7-3- |
| InChIKey | WSWJYARXJLFCLR-CLTKARDFSA-N |
| XLogP | 2.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.96 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|