C23H31FN4O6 — CID 59314598
propan-2-yl 4-[[2-[[2-fluoro-6-(2-methoxyethoxy)-3-pyridinyl]amino]-3-methoxy-4-pyridinyl]oxy]piperidine-1-carboxylate (PubChem CID 59314598) has the molecular formula C23H31FN4O6 and a molecular weight of 478.52 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[[2-fluoro-6-(2-methoxyethoxy)-3-pyridinyl]amino]-3-methoxy-4-pyridinyl]oxy]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[2-[[2-fluoro-6-(2-methoxyethoxy)-3-pyridinyl]amino]-3-methoxy-4-pyridinyl]oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59314598 |
| Molecular Formula | C23H31FN4O6 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | propan-2-yl 4-[[2-[[2-fluoro-6-(2-methoxyethoxy)-3-pyridinyl]amino]-3-methoxy-4-pyridinyl]oxy]piperidine-1-carboxylate |
| SMILES | COCCOc1ccc(Nc2nccc(OC3CCN(C(=O)OC(C)C)CC3)c2OC)c(F)n1 |
| InChI | InChI=1S/C23H31FN4O6/c1-15(2)33-23(29)28-11-8-16(9-12-28)34-18-7-10-25-22(20(18)31-4)26-17-5-6-19(27-21(17)24)32-14-13-30-3/h5-7,10,15-16H,8-9,11-14H2,1-4H3,(H,25,26) |
| InChIKey | QZDDOJWMMQMZGR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|