C28H24N4O5 — CID 59314908
(4-nitrophenyl) 3-benzhydryl-2-methyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (PubChem CID 59314908) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol. Its IUPAC name is (4-nitrophenyl) 3-benzhydryl-2-methyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate.
| Compound Name | (4-nitrophenyl) 3-benzhydryl-2-methyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 59314908 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (4-nitrophenyl) 3-benzhydryl-2-methyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1nc2c(c(=O)n1C(c1ccccc1)c1ccccc1)CN(C(=O)Oc1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C28H24N4O5/c1-19-29-25-16-17-30(28(34)37-23-14-12-22(13-15-23)32(35)36)18-24(25)27(33)31(19)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,26H,16-18H2,1H3 |
| InChIKey | NMOYQPALJHOHAO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|