About CID 59315072
CID 59315072 (PubChem CID 59315072) has the molecular formula C30H41B2N4O6
and a molecular weight of 575.30 g/mol.
Molecular Properties
| Compound Name | CID 59315072 |
| PubChem CID | 59315072 |
| Molecular Formula | C30H41B2N4O6 |
| Molecular Weight | 575.30 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | — |
| SMILES | Cc1cc(B(O)[B]O)ccc1[C@@H](C)CN(C)C(=O)Nc1ccc(-c2c(C)noc2C)c(CN(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C30H41B2N4O6/c1-18-14-23(32(40)31-39)10-12-25(18)19(2)16-35(8)28(37)33-24-11-13-26(27-20(3)34-42-21(27)4)22(15-24)17-36(9)29(38)41-30(5,6)7/h10-15,19,39-40H,16-17H2,1-9H3,(H,33,37)/t19-/m0/s1 |
| InChIKey | LHHVVZYCFZDDKZ-IBGZPJMESA-N |
| XLogP | 4.20 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 575.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59315072 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59315072?
The IUPAC name of CID 59315072 (CID 59315072) is not available.
What is the SMILES notation for CID 59315072?
The canonical SMILES for CID 59315072 is Cc1cc(B(O)[B]O)ccc1[C@@H](C)CN(C)C(=O)Nc1ccc(-c2c(C)noc2C)c(CN(C)C(=O)OC(C)(C)C)c1.
What is the InChIKey of CID 59315072?
The InChIKey is LHHVVZYCFZDDKZ-IBGZPJMESA-N. The full InChI is InChI=1S/C30H41B2N4O6/c1-18-14-23(32(40)31-39)10-12-25(18)19(2)16-35(8)28(37)33-24-11-13-26(27-20(3)34-42-21(27)4)22(15-24)17-36(9)29(38)41-30(5,6)7/h10-15,19,39-40H,16-17H2,1-9H3,(H,33,37)/t19-/m0/s1.
What are the key properties of CID 59315072?
CID 59315072 has a molecular weight of 575.30 g/mol, XLogP of 4.20, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59315072 is sourced from PubChem (CID 59315072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).