About benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate
benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate (PubChem CID 59315880) has the molecular formula C22H24N2O4S
and a molecular weight of 412.51 g/mol. Its IUPAC name is benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate.
Molecular Properties
| Compound Name | benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate |
| PubChem CID | 59315880 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)OCc4ccccc4)ccc31)CN(C)CC2 |
| InChI | InChI=1S/C22H24N2O4S/c1-3-29(26,27)24-20-10-9-17(22(25)28-15-16-7-5-4-6-8-16)13-18(20)19-14-23(2)12-11-21(19)24/h4-10,13H,3,11-12,14-15H2,1-2H3 |
| InChIKey | NWNAPFQGJDONQB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
The IUPAC name of benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate (CID 59315880) is benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate.
What is the SMILES notation for benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
The canonical SMILES for benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate is CCS(=O)(=O)n1c2c(c3cc(C(=O)OCc4ccccc4)ccc31)CN(C)CC2.
What is the InChIKey of benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
The InChIKey is NWNAPFQGJDONQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4S/c1-3-29(26,27)24-20-10-9-17(22(25)28-15-16-7-5-4-6-8-16)13-18(20)19-14-23(2)12-11-21(19)24/h4-10,13H,3,11-12,14-15H2,1-2H3.
What are the key properties of benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate?
benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate has a molecular weight of 412.51 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate is sourced from PubChem (CID 59315880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).