C21H24F3N3O5S — CID 59315999
[1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 59315999) has the molecular formula C21H24F3N3O5S and a molecular weight of 487.50 g/mol. Its IUPAC name is [1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 59315999 |
| Molecular Formula | C21H24F3N3O5S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCC(OC(=O)C(F)(F)F)CC4)ccc31)CNCC2 |
| InChI | InChI=1S/C21H24F3N3O5S/c1-2-33(30,31)27-17-4-3-13(11-15(17)16-12-25-8-5-18(16)27)19(28)26-9-6-14(7-10-26)32-20(29)21(22,23)24/h3-4,11,14,25H,2,5-10,12H2,1H3 |
| InChIKey | GYLQLGPYHWPBHA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |