C16H19N3O2 — CID 59316072
2-cyclopentyl-8-nitro-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 59316072) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-cyclopentyl-8-nitro-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-cyclopentyl-8-nitro-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 59316072 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-cyclopentyl-8-nitro-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | O=[N+]([O-])c1ccc2[nH]c3c(c2c1)CN(C1CCCC1)CC3 |
| InChI | InChI=1S/C16H19N3O2/c20-19(21)12-5-6-15-13(9-12)14-10-18(8-7-16(14)17-15)11-3-1-2-4-11/h5-6,9,11,17H,1-4,7-8,10H2 |
| InChIKey | RFBWHSKMQOMTHF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|