About 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid
4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid (PubChem CID 59316609) has the molecular formula C17H14BrNO4
and a molecular weight of 376.21 g/mol. Its IUPAC name is 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid |
| PubChem CID | 59316609 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid |
| SMILES | O=C1CCc2cc(Br)c(OCc3ccc(C(=O)O)cc3)cc2N1 |
| InChI | InChI=1S/C17H14BrNO4/c18-13-7-12-5-6-16(20)19-14(12)8-15(13)23-9-10-1-3-11(4-2-10)17(21)22/h1-4,7-8H,5-6,9H2,(H,19,20)(H,21,22) |
| InChIKey | LVSNHAOSZHGGQO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid?
The IUPAC name of 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid (CID 59316609) is 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid.
What is the SMILES notation for 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid?
The canonical SMILES for 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid is O=C1CCc2cc(Br)c(OCc3ccc(C(=O)O)cc3)cc2N1.
What is the InChIKey of 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid?
The InChIKey is LVSNHAOSZHGGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO4/c18-13-7-12-5-6-16(20)19-14(12)8-15(13)23-9-10-1-3-11(4-2-10)17(21)22/h1-4,7-8H,5-6,9H2,(H,19,20)(H,21,22).
What are the key properties of 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid?
4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid has a molecular weight of 376.21 g/mol, XLogP of 3.61, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-bromo-2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxymethyl]benzoic acid is sourced from PubChem (CID 59316609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).