C28H38N3O5S+ — CID 59317044
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium (PubChem CID 59317044) has the molecular formula C28H38N3O5S+ and a molecular weight of 528.70 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 59317044 |
| Molecular Formula | C28H38N3O5S+ |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-[3-(4-sulfamoylphenoxy)propyl]azanium |
| SMILES | C[N+](C)(CCCOc1ccc(S(N)(=O)=O)cc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C28H38N3O5S/c1-31(2,18-9-19-35-24-14-16-26(17-15-24)37(29,33)34)21-25-20-30-27(36-25)28(32,22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3,5-6,10-11,14-17,20,23,32H,4,7-9,12-13,18-19,21H2,1-2H3,(H2,29,33,34)/q+1/t28-/m0/s1 |
| InChIKey | MWCXYKSEEDMPEP-NDEPHWFRSA-N |
| XLogP | 4.18 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|