C54H52Cl2N6O18P3+ — CID 59317605
CID 59317605 (PubChem CID 59317605) has the molecular formula C54H52Cl2N6O18P3+ and a molecular weight of 1236.86 g/mol.
| Compound Name | CID 59317605 |
|---|---|
| PubChem CID | 59317605 |
| Molecular Formula | C54H52Cl2N6O18P3+ |
| Molecular Weight | 1236.86 g/mol |
| Exact Mass | 1235.19 |
| IUPAC Name | — |
| SMILES | O=C(NCC#CCc1cn([C@H]2CC[C@@H](COP(OO)(OOO)(P(=O)=O)P(=O)=O)O2)c(=O)[nH]c1=O)c1ccc(CNC(=O)c2cc(Cl)c(-c3c4cc5c6c(c4[o+]c4c7c8c(cc34)CCCN8CCC7)CCCN6CCC5)c(C(=O)O)c2Cl)cc1 |
| InChI | InChI=1S/C54H51Cl2N6O18P3/c55-40-25-39(45(56)44(53(66)67)43(40)42-37-23-31-8-3-19-60-21-5-10-35(46(31)60)48(37)77-49-36-11-6-22-61-20-4-9-32(47(36)61)24-38(42)49)52(65)58-26-29-12-14-30(15-13-29)50(63)57-18-2-1-7-33-27-62(54(68)59-51(33)64)41-17-16-34(76-41)28-75-83(79-70,80-78-69,81(71)72)82(73)74/h12-15,23-25,27,34,41H,3-11,16-22,26,28H2,(H5-,57,58,59,63,64,65,66,67,68,69,70)/p+1/t34-,41+/m0/s1 |
| InChIKey | OTARWRMKVVDWKL-FJOUAFLFSA-O |
| XLogP | 9.77 |
| TPSA | 323.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 83 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1236.86 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|