C27H26FN5O3 — CID 59318044
4-[4-[5-[(1-ethylindol-6-yl)carbamoyl]-2-pyridinyl]piperazin-1-yl]-2-fluorobenzoic acid (PubChem CID 59318044) has the molecular formula C27H26FN5O3 and a molecular weight of 487.54 g/mol. Its IUPAC name is 4-[4-[5-[(1-ethylindol-6-yl)carbamoyl]-2-pyridinyl]piperazin-1-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[4-[5-[(1-ethylindol-6-yl)carbamoyl]-2-pyridinyl]piperazin-1-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 59318044 |
| Molecular Formula | C27H26FN5O3 |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 4-[4-[5-[(1-ethylindol-6-yl)carbamoyl]-2-pyridinyl]piperazin-1-yl]-2-fluorobenzoic acid |
| SMILES | CCn1ccc2ccc(NC(=O)c3ccc(N4CCN(c5ccc(C(=O)O)c(F)c5)CC4)nc3)cc21 |
| InChI | InChI=1S/C27H26FN5O3/c1-2-31-10-9-18-3-5-20(15-24(18)31)30-26(34)19-4-8-25(29-17-19)33-13-11-32(12-14-33)21-6-7-22(27(35)36)23(28)16-21/h3-10,15-17H,2,11-14H2,1H3,(H,30,34)(H,35,36) |
| InChIKey | XDSYGMNIHCDXAQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |