About methyl 2-(diphenylphosphorylamino)acetate;praseodymium
methyl 2-(diphenylphosphorylamino)acetate;praseodymium (PubChem CID 59318212) has the molecular formula C15H15NO3PPr-
and a molecular weight of 429.17 g/mol. Its IUPAC name is methyl 2-(diphenylphosphorylamino)acetate;praseodymium.
Molecular Properties
| Compound Name | methyl 2-(diphenylphosphorylamino)acetate;praseodymium |
| PubChem CID | 59318212 |
| Molecular Formula | C15H15NO3PPr- |
| Molecular Weight | 429.17 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | methyl 2-(diphenylphosphorylamino)acetate;praseodymium |
| SMILES | COC(=O)[CH-]NP(=O)(c1ccccc1)c1ccccc1.[Pr] |
| InChI | InChI=1S/C15H15NO3P.Pr/c1-19-15(17)12-16-20(18,13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-12H,1H3,(H,16,18);/q-1; |
| InChIKey | MYCNIAGLXOFMRI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(diphenylphosphorylamino)acetate;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(diphenylphosphorylamino)acetate;praseodymium?
The IUPAC name of methyl 2-(diphenylphosphorylamino)acetate;praseodymium (CID 59318212) is methyl 2-(diphenylphosphorylamino)acetate;praseodymium.
What is the SMILES notation for methyl 2-(diphenylphosphorylamino)acetate;praseodymium?
The canonical SMILES for methyl 2-(diphenylphosphorylamino)acetate;praseodymium is COC(=O)[CH-]NP(=O)(c1ccccc1)c1ccccc1.[Pr].
What is the InChIKey of methyl 2-(diphenylphosphorylamino)acetate;praseodymium?
The InChIKey is MYCNIAGLXOFMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3P.Pr/c1-19-15(17)12-16-20(18,13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-12H,1H3,(H,16,18);/q-1;.
What are the key properties of methyl 2-(diphenylphosphorylamino)acetate;praseodymium?
methyl 2-(diphenylphosphorylamino)acetate;praseodymium has a molecular weight of 429.17 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(diphenylphosphorylamino)acetate;praseodymium is sourced from PubChem (CID 59318212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).