C17H21NO8 — CID 59318483
dimethyl (3S)-5-oxo-3-(2,4,6-trimethoxyphenyl)pyrrolidine-2,4-dicarboxylate (PubChem CID 59318483) has the molecular formula C17H21NO8 and a molecular weight of 367.35 g/mol. Its IUPAC name is dimethyl (3S)-5-oxo-3-(2,4,6-trimethoxyphenyl)pyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (3S)-5-oxo-3-(2,4,6-trimethoxyphenyl)pyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 59318483 |
| Molecular Formula | C17H21NO8 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | dimethyl (3S)-5-oxo-3-(2,4,6-trimethoxyphenyl)pyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C1NC(=O)C(C(=O)OC)[C@H]1c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C17H21NO8/c1-22-8-6-9(23-2)11(10(7-8)24-3)12-13(16(20)25-4)15(19)18-14(12)17(21)26-5/h6-7,12-14H,1-5H3,(H,18,19)/t12-,13?,14?/m1/s1 |
| InChIKey | FRXQVOYXWZGMLI-IYXRBSQSSA-N |
| XLogP | 0.26 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|