About (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene]
(1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] (PubChem CID 59318731) has the molecular formula C22H24
and a molecular weight of 288.43 g/mol. Its IUPAC name is (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene].
Molecular Properties
| Compound Name | (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] |
| PubChem CID | 59318731 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] |
| SMILES | Cc1ccc2c(c1)C1(/C=C\CCCCC1)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C22H24/c1-16-8-10-18-19-11-9-17(2)15-21(19)22(20(18)14-16)12-6-4-3-5-7-13-22/h6,8-12,14-15H,3-5,7,13H2,1-2H3/b12-6- |
| InChIKey | IBNFRWGMHKJRMV-SDQBBNPISA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene]?
The IUPAC name of (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] (CID 59318731) is (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene].
What is the SMILES notation for (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene]?
The canonical SMILES for (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] is Cc1ccc2c(c1)C1(/C=C\CCCCC1)c1cc(C)ccc1-2.
What is the InChIKey of (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene]?
The InChIKey is IBNFRWGMHKJRMV-SDQBBNPISA-N. The full InChI is InChI=1S/C22H24/c1-16-8-10-18-19-11-9-17(2)15-21(19)22(20(18)14-16)12-6-4-3-5-7-13-22/h6,8-12,14-15H,3-5,7,13H2,1-2H3/b12-6-.
What are the key properties of (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene]?
(1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] has a molecular weight of 288.43 g/mol, XLogP of 6.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2',7'-dimethylspiro[cyclooctene-3,9'-fluorene] is sourced from PubChem (CID 59318731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).