About 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one
1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one (PubChem CID 59319507) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one.
Molecular Properties
| Compound Name | 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one |
| PubChem CID | 59319507 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one |
| SMILES | CCn1ncc2c1C(=O)N(C)CC2 |
| InChI | InChI=1S/C9H13N3O/c1-3-12-8-7(6-10-12)4-5-11(2)9(8)13/h6H,3-5H2,1-2H3 |
| InChIKey | OYTQMSWIGQZLCA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one?
The IUPAC name of 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one (CID 59319507) is 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one.
What is the SMILES notation for 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one?
The canonical SMILES for 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one is CCn1ncc2c1C(=O)N(C)CC2.
What is the InChIKey of 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one?
The InChIKey is OYTQMSWIGQZLCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-3-12-8-7(6-10-12)4-5-11(2)9(8)13/h6H,3-5H2,1-2H3.
What are the key properties of 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one?
1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one has a molecular weight of 179.22 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one is sourced from PubChem (CID 59319507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).